CAS 1213-82-7
:10-Chloro-9-cyanoanthracene
Description:
10-Chloro-9-cyanoanthracene is an organic compound belonging to the anthracene family, characterized by the presence of a chlorine atom and a cyano group attached to the anthracene structure. This compound typically appears as a solid with a crystalline form and exhibits a deep color, often associated with its aromatic nature. It is known for its photophysical properties, making it useful in various applications, including organic electronics and as a fluorescent probe in chemical research. The presence of the cyano group contributes to its electron-withdrawing characteristics, influencing its reactivity and stability. Additionally, the chlorine substituent can affect the compound's solubility and interaction with other chemical species. 10-Chloro-9-cyanoanthracene is generally handled with care due to potential toxicity and environmental concerns, necessitating appropriate safety measures during its use in laboratory settings. Its synthesis typically involves multi-step organic reactions, highlighting its complexity and the importance of precise chemical manipulation in its production.
Formula:C15H8ClN
InChI:InChI=1/C15H8ClN/c16-15-12-7-3-1-5-10(12)14(9-17)11-6-2-4-8-13(11)15/h1-8H
SMILES:c1ccc2c(c1)c(C#N)c1ccccc1c2Cl
Synonyms:- 10-Chloroanthracene-9-Carbonitrile
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.