CAS 1213050-63-5
:(αR)-α-Methyl-3-(trifluoromethyl)-2-pyridinemethanamine
Description:
(αR)-α-Methyl-3-(trifluoromethyl)-2-pyridinemethanamine is a chemical compound characterized by its pyridine ring, which is a six-membered aromatic heterocycle containing one nitrogen atom. The presence of a trifluoromethyl group (-CF3) at the 3-position of the pyridine ring significantly influences its electronic properties, enhancing lipophilicity and potentially affecting its reactivity and biological activity. The α-methyl group indicates a chiral center, contributing to its stereochemistry, which can impact its pharmacological properties. This compound may exhibit various interactions due to the amino group (-NH2), which can participate in hydrogen bonding and influence solubility in polar solvents. Its unique structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals targeting specific biological pathways. The compound's CAS number, 1213050-63-5, allows for precise identification and retrieval of information regarding its properties, safety data, and regulatory status in chemical databases.
Formula:C8H9F3N2
InChI:InChI=1S/C8H9F3N2/c1-5(12)7-6(8(9,10)11)3-2-4-13-7/h2-5H,12H2,1H3/t5-/m1/s1
InChI key:InChIKey=HFANFFHVMQXJOE-RXMQYKEDSA-N
SMILES:C(F)(F)(F)C1=C([C@@H](C)N)N=CC=C1
Synonyms:- (αR)-α-Methyl-3-(trifluoromethyl)-2-pyridinemethanamine
- 2-Pyridinemethanamine, α-methyl-3-(trifluoromethyl)-, (αR)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.