
CAS 121307-28-6
:4-Propoxy-2-(trifluoromethyl)benzenamine
Description:
4-Propoxy-2-(trifluoromethyl)benzenamine, with the CAS number 121307-28-6, is an organic compound characterized by the presence of a propoxy group and a trifluoromethyl group attached to a benzene ring that also contains an amino group. This compound typically exhibits properties associated with aromatic amines, such as moderate solubility in organic solvents and potential reactivity due to the amino group. The trifluoromethyl group enhances the compound's lipophilicity and can influence its electronic properties, making it a candidate for various applications in pharmaceuticals and agrochemicals. The presence of the propoxy group may also contribute to its solubility and stability in different environments. As with many aromatic amines, safety considerations are important, as they may pose health risks, including potential carcinogenicity. Overall, 4-Propoxy-2-(trifluoromethyl)benzenamine is a compound of interest in synthetic organic chemistry and material science, with its unique functional groups offering diverse reactivity and application potential.
Formula:C10H12F3NO
InChI:InChI=1S/C10H12F3NO/c1-2-5-15-7-3-4-9(14)8(6-7)10(11,12)13/h3-4,6H,2,5,14H2,1H3
InChI key:InChIKey=VDBYZLYKRUPIFO-UHFFFAOYSA-N
SMILES:C(F)(F)(F)C1=CC(OCCC)=CC=C1N
Synonyms:- 4-Propoxy-2-(trifluoromethyl)benzenamine
- Benzenamine, 4-propoxy-2-(trifluoromethyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.