CAS 121307-83-3
:6-chloro-4-(trifluoromethyl)-2(1H)-Pyridinethione
Description:
6-Chloro-4-(trifluoromethyl)-2(1H)-pyridinethione is a heterocyclic compound characterized by the presence of a pyridine ring substituted with a chlorine atom and a trifluoromethyl group, as well as a thione functional group. The molecular structure features a nitrogen atom in the pyridine ring, contributing to its basicity and potential reactivity. The trifluoromethyl group is known for its electron-withdrawing properties, which can influence the compound's reactivity and stability. This compound may exhibit biological activity, making it of interest in pharmaceutical research. Its thione group can participate in various chemical reactions, including nucleophilic attacks and coordination with metal ions. The presence of chlorine and trifluoromethyl groups can also enhance lipophilicity, potentially affecting the compound's solubility and permeability in biological systems. Overall, 6-chloro-4-(trifluoromethyl)-2(1H)-pyridinethione is a versatile compound with applications in medicinal chemistry and material science, warranting further investigation into its properties and potential uses.
Formula:C6H3ClF3NS
InChI:InChI=1/C6H3ClF3NS/c7-4-1-3(6(8,9)10)2-5(12)11-4/h1-2H,(H,11,12)
SMILES:c1c(cc(nc1Cl)S)C(F)(F)F
Synonyms:- 2(1H)-pyridinethione, 6-chloro-4-(trifluoromethyl)-
- 6-Chloro-4-(trifluoromethyl)pyridine-2(1H)-thione
- 6-chloro-4-(trifluoromethyl)-1H-pyridine-2-thione
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
