CAS 1213144-64-9

(αR)-5-Chloro-α-methyl-3-pyridinemethanamine

Description:

(αR)-5-Chloro-α-methyl-3-pyridinemethanamine, identified by its CAS number 1213144-64-9, is a chemical compound that belongs to the class of pyridine derivatives. This substance features a pyridine ring, which is a six-membered aromatic ring containing one nitrogen atom, and is substituted with a chlorine atom and an α-methyl group. The presence of the amino group (-NH2) indicates that it is an amine, which can participate in various chemical reactions, including nucleophilic substitutions and complexation with acids to form salts. The chirality of the compound, denoted by the (αR) configuration, suggests that it exists as a specific enantiomer, which can exhibit distinct biological activities compared to its mirror image. Such compounds often have applications in pharmaceuticals and agrochemicals due to their potential biological activity. The physical properties, such as solubility, melting point, and stability, would depend on the specific molecular interactions and the environment in which the compound is placed.

Formula: C₇H₉ClN₂

InChI: InChI=1S/C7H9ClN2/c1-5(9)6-2-7(8)4-10-3-6/h2-5H,9H2,1H3/t5-/m1/s1

InChI key: InChIKey=HVGKGOMAGDQVDC-RXMQYKEDSA-N

SMILES: [C@H](C)(N)C=1C=C(Cl)C=NC1

Synonyms:

• 3-Pyridinemethanamine, 5-chloro-α-methyl-, (αR)-
• (αR)-5-Chloro-α-methyl-3-pyridinemethanamine

3-Pyridinemethanamine, 5-chloro-α-methyl-, (αR)-

CAS: 1213144-64-9

Formula: C₇H₉ClN₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 156.6128

Ref: IN-DA01OHDA

(R)-1-(5-Chloropyridin-3-yl)ethanamine

CAS: 1213144-64-9

(R)-1-(5-Chloropyridin-3-yl)ethanamine

Purity: 98%

Molecular weight: 156.61g/mol

Ref: 54-OR87836

(R)-1-(5-Chloropyridin-3-yl)ethanamine

CAS: 1213144-64-9

Purity: 98%

Molecular weight: 156.6100006

Ref: 10-F781207