CAS 1213208-01-5

(αS)-α-Methyl-5-nitro-2-furanmethanamine

Description:

(αS)-α-Methyl-5-nitro-2-furanmethanamine is a chemical compound characterized by its unique structural features, which include a furan ring and a nitro group. This compound is an amine derivative, indicating the presence of an amino group (-NH2) attached to a furan-based structure. The α-methyl group contributes to its stereochemistry, specifically the (αS) configuration, which can influence its biological activity and interactions. The nitro group is known for its potential reactivity and can participate in various chemical reactions, including reduction processes. This compound may exhibit specific pharmacological properties, making it of interest in medicinal chemistry. Its solubility, stability, and reactivity can vary based on environmental conditions such as pH and temperature. As with many organic compounds, safety and handling precautions are essential due to potential toxicity or reactivity. Overall, (αS)-α-Methyl-5-nitro-2-furanmethanamine represents a complex structure with potential applications in research and development within the fields of chemistry and pharmacology.

Formula: C₆H₈N₂O₃

InChI: InChI=1S/C6H8N2O3/c1-4(7)5-2-3-6(11-5)8(9)10/h2-4H,7H2,1H3/t4-/m0/s1

InChI key: InChIKey=ORFZKTNPEZKQCU-BYPYZUCNSA-N

SMILES: [C@@H](C)(N)C=1OC(N(=O)=O)=CC1

Synonyms:

• 2-Furanmethanamine, α-methyl-5-nitro-, (αS)-
• (αS)-α-Methyl-5-nitro-2-furanmethanamine