CymitQuimica logo

CAS 1213213-26-3

:

Methyl (3S)-3-amino-2,3-dihydro-1H-indene-5-carboxylate

Description:
Methyl (3S)-3-amino-2,3-dihydro-1H-indene-5-carboxylate is a chemical compound characterized by its indene structure, which features a fused ring system that contributes to its unique properties. The presence of an amino group at the 3-position and a carboxylate ester at the 5-position enhances its reactivity and potential for biological activity. This compound is typically a white to off-white solid, and its solubility can vary depending on the solvent used, often being more soluble in polar organic solvents. The stereochemistry indicated by the (3S) designation suggests that it has specific spatial arrangements that may influence its interaction with biological targets, making it of interest in medicinal chemistry. Its molecular structure allows for potential applications in pharmaceuticals, particularly in the development of compounds that can modulate biological pathways. As with many organic compounds, safety and handling precautions should be observed, as it may exhibit toxicity or other hazardous properties.
Formula:C11H13NO2
InChI:InChI=1S/C11H13NO2/c1-14-11(13)8-3-2-7-4-5-10(12)9(7)6-8/h2-3,6,10H,4-5,12H2,1H3/t10-/m0/s1
InChI key:InChIKey=WVMGINRJNBISMA-JTQLQIEISA-N
SMILES:N[C@@H]1C=2C(=CC=C(C(OC)=O)C2)CC1
Synonyms:
  • Methyl (3S)-3-amino-2,3-dihydro-1H-indene-5-carboxylate
  • 1H-Indene-5-carboxylic acid, 3-amino-2,3-dihydro-, methyl ester, (3S)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.