CymitQuimica logo

CAS 121325-44-8

:

methyl 5-[2-chloro-5-(trifluoromethyl)phenoxy]-2-nitrobenzoate

Description:
Methyl 5-[2-chloro-5-(trifluoromethyl)phenoxy]-2-nitrobenzoate, with the CAS number 121325-44-8, is an organic compound characterized by its complex molecular structure, which includes a nitro group, a chloro substituent, and a trifluoromethyl group. This compound typically exhibits properties associated with aromatic compounds, such as stability and potential for electrophilic substitution reactions. The presence of the nitro group suggests it may have polar characteristics, influencing its solubility in various solvents. The trifluoromethyl group often imparts unique electronic properties, enhancing the compound's lipophilicity and potentially affecting its biological activity. Methyl esters like this one are generally known for their reactivity in esterification and hydrolysis reactions. Additionally, the chlorinated and trifluoromethylated aromatic systems may exhibit interesting interactions in biological systems, making such compounds of interest in pharmaceutical and agrochemical research. Overall, this compound's unique functional groups contribute to its potential applications in various chemical and industrial processes.
Formula:C15H9ClF3NO5
InChI:InChI=1/C15H9ClF3NO5/c1-24-14(21)10-7-9(3-5-12(10)20(22)23)25-13-6-8(15(17,18)19)2-4-11(13)16/h2-7H,1H3
SMILES:COC(=O)c1cc(ccc1N(=O)=O)Oc1cc(ccc1Cl)C(F)(F)F
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.