CymitQuimica logo

CAS 1213269-48-7

:

Methyl 2,3,4,5-tetrafluoro-α-[[[(1S)-2-hydroxy-1-methylethyl]amino]methylene]-β-oxobenzenepropanoate

Description:
Methyl 2,3,4,5-tetrafluoro-α-[[[(1S)-2-hydroxy-1-methylethyl]amino]methylene]-β-oxobenzenepropanoate, identified by its CAS number 1213269-48-7, is a complex organic compound characterized by its unique molecular structure, which includes multiple functional groups and fluorine substituents. The presence of tetrafluoro groups indicates a high degree of fluorination, which can enhance the compound's stability, lipophilicity, and potential biological activity. The molecule features an α-amino acid derivative, suggesting possible applications in pharmaceuticals or biochemistry, particularly in drug design or as a biochemical probe. The hydroxyl group contributes to its potential solubility in polar solvents, while the methylene and oxobenzene moieties may influence its reactivity and interaction with biological targets. Overall, this compound's intricate structure and functional diversity make it a subject of interest in various fields, including medicinal chemistry and materials science, where fluorinated compounds are often explored for their unique properties.
Formula:C14H13F4NO4
InChI:InChI=1S/C14H13F4NO4/c1-6(5-20)19-4-8(14(22)23-2)13(21)7-3-9(15)11(17)12(18)10(7)16/h3-4,6,19-20H,5H2,1-2H3/t6-/m0/s1
InChI key:InChIKey=WYUVOLQMUDCHLG-LURJTMIESA-N
SMILES:C(C(=CN[C@H](CO)C)C(OC)=O)(=O)C1=C(F)C(F)=C(F)C(F)=C1
Synonyms:
  • Benzenepropanoic acid, 2,3,4,5-tetrafluoro-α-[[[(1S)-2-hydroxy-1-methylethyl]amino]methylene]-β-oxo-, methyl ester
  • Methyl 2,3,4,5-tetrafluoro-α-[[[(1S)-2-hydroxy-1-methylethyl]amino]methylene]-β-oxobenzenepropanoate
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.