CAS 1213315-89-9

(3S)-2,3-Dihydro-3,6-benzofurandiamine

Description:

(3S)-2,3-Dihydro-3,6-benzofurandiamine is a chemical compound characterized by its unique bicyclic structure, which includes a benzofuran moiety and two amine functional groups. This compound is typically classified as an amine due to the presence of the amino groups, which can participate in hydrogen bonding and influence its solubility and reactivity. The stereochemistry indicated by the (3S) designation suggests that it has specific spatial arrangements that can affect its biological activity and interactions with other molecules. The presence of the benzofuran ring contributes to its potential applications in medicinal chemistry, as such structures are often found in biologically active compounds. Additionally, the compound may exhibit properties such as moderate to high polarity, which can affect its behavior in various solvents and environments. Its CAS number, 1213315-89-9, allows for precise identification and retrieval of information regarding its properties, safety data, and potential applications in research and industry.

Formula: C₈H₁₀N₂O

InChI: InChI=1S/C8H10N2O/c9-5-1-2-6-7(10)4-11-8(6)3-5/h1-3,7H,4,9-10H2/t7-/m1/s1

InChI key: InChIKey=NUBUAOZJUKDCCF-SSDOTTSWSA-N

SMILES: N[C@H]1C=2C(OC1)=CC(N)=CC2

Synonyms:

• (3S)-2,3-Dihydro-3,6-benzofurandiamine
• 3,6-Benzofurandiamine, 2,3-dihydro-, (3S)-