CAS 1213363-91-7

(αR)-2-Chloro-α-ethenyl-5-fluorobenzenemethanamine

Description:

(αR)-2-Chloro-α-ethenyl-5-fluorobenzenemethanamine, with the CAS number 1213363-91-7, is a chemical compound characterized by its unique structural features, which include a chloro group, a vinyl group, and a fluorobenzene moiety. This compound is likely to exhibit properties typical of amines, such as basicity and the ability to form hydrogen bonds, which can influence its solubility and reactivity. The presence of the chloro and fluoro substituents can significantly affect its electronic properties, potentially enhancing its reactivity in nucleophilic substitution reactions or influencing its interaction with biological targets. Additionally, the stereochemistry indicated by the (αR) designation suggests that the compound has specific spatial arrangements that may impact its biological activity and pharmacological profile. Overall, this compound may have applications in medicinal chemistry or material science, depending on its specific properties and reactivity patterns. Further studies would be necessary to elucidate its full range of characteristics and potential applications.

Formula: C₉H₉ClFN

InChI: InChI=1S/C9H9ClFN/c1-2-9(12)7-5-6(11)3-4-8(7)10/h2-5,9H,1,12H2/t9-/m1/s1

InChI key: InChIKey=NAHXKQNPZJBULU-SECBINFHSA-N

SMILES: [C@H](C=C)(N)C1=C(Cl)C=CC(F)=C1

Synonyms:

• (αR)-2-Chloro-α-ethenyl-5-fluorobenzenemethanamine
• Benzenemethanamine, 2-chloro-α-ethenyl-5-fluoro-, (αR)-