CAS 1213452-84-6

(βR)-β-Amino-2-chloro-4-methoxybenzeneethanol

Description:

(βR)-β-Amino-2-chloro-4-methoxybenzeneethanol, identified by its CAS number 1213452-84-6, is a chemical compound characterized by its specific structural features. It contains an amino group (-NH2), a chloro substituent (-Cl), and a methoxy group (-OCH3) attached to a benzene ring, along with an ethanol moiety. The presence of the β-amino group suggests that it may exhibit basic properties, while the chloro and methoxy groups can influence its reactivity and solubility. This compound is likely to be a chiral molecule, with the (βR) designation indicating its specific stereochemistry, which can affect its biological activity and interactions. The methoxy group typically enhances lipophilicity, potentially impacting its pharmacokinetic properties. Overall, the unique combination of functional groups in (βR)-β-Amino-2-chloro-4-methoxybenzeneethanol suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals or agrochemicals, although specific applications would depend on further research into its biological activity and chemical behavior.

Formula: C₉H₁₂ClNO₂

InChI: InChI=1S/C9H12ClNO2/c1-13-6-2-3-7(8(10)4-6)9(11)5-12/h2-4,9,12H,5,11H2,1H3/t9-/m0/s1

InChI key: InChIKey=RKFJULZVYGOVPL-VIFPVBQESA-N

SMILES: [C@@H](CO)(N)C1=C(Cl)C=C(OC)C=C1

Synonyms:

• Benzeneethanol, β-amino-2-chloro-4-methoxy-, (βR)-
• (βR)-β-Amino-2-chloro-4-methoxybenzeneethanol