CAS 121346-32-5

3,4-DIMETHOXY-N-METHYL-N-[3-[4-[[1-METHYL-3-(1-METHYLETHYL)-1H-INDOL-2-YL]SULFONYL]PHENOXY]PROPYL]BENZENEETHANAMINE OXALATE

Description:

3,4-Dimethoxy-N-methyl-N-[3-[4-[[1-methyl-3-(1-methylethyl)-1H-indol-2-yl]sulfonyl]phenoxy]propyl]benzeneethanamine oxalate, identified by CAS number 121346-32-5, is a complex organic compound characterized by its intricate molecular structure, which includes multiple functional groups such as methoxy, sulfonyl, and amine. This compound is typically categorized as a pharmaceutical or research chemical, often investigated for its potential biological activity. The presence of the indole moiety suggests possible interactions with neurotransmitter systems, making it of interest in neuropharmacology. Its oxalate salt form indicates that it may be used to enhance solubility and stability in various formulations. The compound's synthesis involves multiple steps, reflecting its complexity, and it may exhibit specific physicochemical properties such as solubility in organic solvents and potential bioactivity. Safety and handling precautions are essential due to the potential for biological activity and the presence of sulfonyl and amine groups, which can influence reactivity and toxicity.

Formula: C₃₄H₄₂N₂O₉S

InChI: InChI=1/C31H38N2O5S.C3H4O4/c1-22(2)30-26-9-6-7-10-27(26)32-31(30)39(34,35)25-14-12-24(13-15-25)38-20-8-18-33(3)19-17-23-11-16-28(36-4)29(21-23)37-5;4-2(5)1-3(6)7/h6-7,9-16,21-22,32H,8,17-20H2,1-5H3;1H2,(H,4,5)(H,6,7)

SMILES: CC(C)c1c2ccccc2[nH]c1S(=O)(=O)c1ccc(cc1)OCCCN(C)CCc1ccc(c(c1)OC)OC.C(C(=O)O)C(=O)O

Synonyms:

• Sr 33805 Oxalate
• 3,4-Dimethoxy-N-methyl-N-(3-(4-((1-methyl-3-(1-methylethyl)-1H-indol-2-yl)sulfonyl)phenoxy)propyl)benzeneethanamineoxal]
• propanedioic acid - N-[2-(3,4-dimethoxyphenyl)ethyl]-N-methyl-3-(4-{[3-(1-methylethyl)-1H-indol-2-yl]sulfonyl}phenoxy)propan-1-amine (1:1)

SR-33805

CAS: 121346-32-5

SR-33805: calcium channel blocker for atherosclerosis/heart failure, enhances myocyte function, modulates myofilament phosphorylation.

Formula: C₃₂H₄₀N₂O₅S

Color and Shape: Solid

Molecular weight: 564.74

Ref: TM-T71223