CAS 1213465-22-5

(αS)-α-Methyl-1H-indole-3-methanamine

Description:

(αS)-α-Methyl-1H-indole-3-methanamine, with the CAS number 1213465-22-5, is a chemical compound characterized by its indole structure, which is a bicyclic compound consisting of a benzene ring fused to a pyrrole ring. This specific compound features a methyl group at the alpha position and an amine functional group, which contributes to its basicity and potential reactivity. The stereochemistry indicated by (αS) suggests that it has a specific spatial arrangement, which can influence its biological activity and interactions with other molecules. Indole derivatives are known for their presence in various natural products and pharmaceuticals, often exhibiting diverse biological activities, including antimicrobial and psychoactive properties. The presence of the methanamine group may enhance its solubility and reactivity in biological systems. Overall, (αS)-α-Methyl-1H-indole-3-methanamine is of interest in medicinal chemistry and pharmacology due to its structural features and potential applications.

Formula: C₁₀H₁₂N₂

InChI: InChI=1S/C10H12N2/c1-7(11)9-6-12-10-5-3-2-4-8(9)10/h2-7,12H,11H2,1H3/t7-/m0/s1

InChI key: InChIKey=VBNMNLNTLNOVIT-ZETCQYMHSA-N

SMILES: [C@@H](C)(N)C=1C=2C(NC1)=CC=CC2

Synonyms:

• (αS)-α-Methyl-1H-indole-3-methanamine
• 1H-Indole-3-methanamine, α-methyl-, (αS)-