
CAS 1213473-31-4
:(βR)-β-Amino-4-nitrobenzeneethanol
Description:
(βR)-β-Amino-4-nitrobenzeneethanol is an organic compound characterized by the presence of both an amino group and a nitro group attached to a benzene ring, along with an ethanol moiety. The compound features a chiral center, which contributes to its stereochemical properties, specifically the (βR) configuration. This configuration can influence its biological activity and interactions with other molecules. The nitro group typically imparts electron-withdrawing characteristics, affecting the compound's reactivity and solubility in various solvents. The amino group can participate in hydrogen bonding, enhancing its potential for interactions in biological systems. As a result, (βR)-β-Amino-4-nitrobenzeneethanol may exhibit interesting pharmacological properties, making it a subject of interest in medicinal chemistry. Its specific applications and behavior in chemical reactions would depend on its structural features and the functional groups present. Overall, this compound exemplifies the complexity of organic molecules and their potential utility in various scientific fields.
Formula:C8H10N2O3
InChI:InChI=1S/C8H10N2O3/c9-8(5-11)6-1-3-7(4-2-6)10(12)13/h1-4,8,11H,5,9H2/t8-/m0/s1
InChI key:InChIKey=WWDKYXJKHQRFGX-QMMMGPOBSA-N
SMILES:[C@@H](CO)(N)C1=CC=C(N(=O)=O)C=C1
Synonyms:- Benzeneethanol, β-amino-4-nitro-, (βR)-
- (βR)-β-Amino-4-nitrobenzeneethanol
- (2R)-2-Amino-2-(4-nitrophenyl)ethan-1-ol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.