CAS 121353-87-5
:3',3'-difluoro-3'-deoxythymidine
Description:
3',3'-Difluoro-3'-deoxythymidine, commonly referred to as dFdT, is a nucleoside analog of thymidine, characterized by the substitution of two fluorine atoms at the 3' position of the sugar moiety. This modification enhances its stability and alters its interaction with nucleic acid synthesis pathways. As a prodrug, dFdT is primarily utilized in antiviral and anticancer therapies, particularly in the treatment of HIV and certain types of cancer, due to its ability to inhibit viral replication and DNA synthesis. The presence of fluorine atoms contributes to its unique pharmacological properties, including improved bioavailability and reduced susceptibility to enzymatic degradation. dFdT is typically administered in a phosphorylated form, which is then activated within the cell to exert its therapeutic effects. Its mechanism of action involves incorporation into viral or cellular DNA, leading to chain termination and ultimately inhibiting further replication. Overall, 3',3'-difluoro-3'-deoxythymidine represents a significant advancement in the development of antiviral and anticancer agents.
Formula:C10H12F2N2O4
InChI:InChI=1/C10H12F2N2O4/c1-5-3-14(9(17)13-8(5)16)7-2-10(11,12)6(4-15)18-7/h3,6-7,15H,2,4H2,1H3,(H,13,16,17)/t6-,7-/m1/s1
SMILES:Cc1cn([C@H]2CC([C@@H](CO)O2)(F)F)c(=O)nc1O
Synonyms:- 3'-Deoxy-3',3'-difluorothymidine
- 3-Fluoro-1-(3'-fluoro-2',3'-dideoxy-beta-D-ribofuranosyl)-5-methyluracil
- 3-Fluoro-1-(3'-fluoro-3'-deoxy-beta-D-erythropentofuranosyl)thymine
- F2dT
- Thymidine, 3'-deoxy-3',3'-difluoro-
- 1-[(2R,5R)-4,4-difluoro-5-(hydroxymethyl)tetrahydrofuran-2-yl]-5-methylpyrimidine-2,4(1H,3H)-dione
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.