
CAS 1213560-35-0
:(4R)-6-Bromo-3,4-dihydro-7-methyl-2H-1-benzopyran-4-amine
Description:
(4R)-6-Bromo-3,4-dihydro-7-methyl-2H-1-benzopyran-4-amine is a chemical compound characterized by its unique bicyclic structure, which includes a benzopyran moiety. This compound features a bromine atom at the 6-position and an amine group at the 4-position, contributing to its reactivity and potential biological activity. The presence of the methyl group at the 7-position influences its steric and electronic properties, which can affect its interaction with biological targets. The stereochemistry indicated by the (4R) designation suggests that the compound has specific spatial arrangements that may be crucial for its pharmacological effects. As a benzopyran derivative, it may exhibit properties typical of flavonoids, such as antioxidant activity. The compound's solubility, stability, and reactivity can vary based on its functional groups and the surrounding environment. Overall, this compound may have potential applications in medicinal chemistry, particularly in the development of therapeutic agents targeting various biological pathways.
Formula:C10H12BrNO
InChI:InChI=1S/C10H12BrNO/c1-6-4-10-7(5-8(6)11)9(12)2-3-13-10/h4-5,9H,2-3,12H2,1H3/t9-/m1/s1
InChI key:InChIKey=WTCDOBVYPQNVCJ-SECBINFHSA-N
SMILES:N[C@H]1C=2C(=CC(C)=C(Br)C2)OCC1
Synonyms:- 2H-1-Benzopyran-4-amine, 6-bromo-3,4-dihydro-7-methyl-, (4R)-
- (4R)-6-Bromo-3,4-dihydro-7-methyl-2H-1-benzopyran-4-amine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.