CAS 121362-23-0

(2E)-2-(4-methylpent-3-en-1-ylidene)butanedial

Description:

(2E)-2-(4-methylpent-3-en-1-ylidene)butanedial, with the CAS number 121362-23-0, is an organic compound characterized by its unique structure, which includes a butanedial backbone and a substituted alkenyl group. This compound features two aldehyde functional groups, which are indicative of its reactivity and potential applications in organic synthesis. The presence of the (2E) configuration suggests that it has a specific geometric arrangement around the double bond, influencing its physical and chemical properties. Typically, compounds with such structures may exhibit properties like volatility and solubility in organic solvents, making them useful in various chemical reactions, including condensation and addition reactions. Additionally, the presence of the methyl and pentenyl substituents can affect the compound's stability and reactivity, potentially leading to interesting interactions in biological systems or materials science. Overall, this compound represents a class of versatile intermediates in organic chemistry, with potential applications in the synthesis of more complex molecules.

Formula: C₁₀H₁₄O₂

InChI: InChI=1/C10H14O2/c1-9(2)4-3-5-10(8-12)6-7-11/h4-5,7-8H,3,6H2,1-2H3/b10-5+

(E)-2-(4-Methyl-3-pentenylidene)-butanedial

Controlled Product

CAS: 121362-23-0

Formula: C₁₀H₁₄O₂

Color and Shape: Neat

Molecular weight: 166.22

Ref: TR-M232470