
CAS 1213648-97-5
:Methyl (βR)-β-amino-4-methylbenzenepropanoate
Description:
Methyl (βR)-β-amino-4-methylbenzenepropanoate, with the CAS number 1213648-97-5, is an organic compound characterized by its structure, which includes a methyl ester functional group and an amino group attached to a propanoate backbone. This compound features a chiral center, indicated by the (βR) designation, which implies that it exists in a specific stereoisomeric form. The presence of the 4-methylbenzene moiety contributes to its aromatic characteristics, potentially influencing its solubility and reactivity. Generally, compounds of this nature may exhibit biological activity, making them of interest in pharmaceutical applications. The methyl ester group suggests that it may undergo hydrolysis to release the corresponding carboxylic acid and methanol, which is a common reaction for esters. Additionally, the amino group may participate in various chemical reactions, including acylation and alkylation, further expanding its utility in synthetic organic chemistry. Overall, the compound's unique structural features position it as a potentially valuable intermediate in organic synthesis and medicinal chemistry.
Formula:C11H15NO2
InChI:InChI=1S/C11H15NO2/c1-8-3-5-9(6-4-8)10(12)7-11(13)14-2/h3-6,10H,7,12H2,1-2H3/t10-/m1/s1
InChI key:InChIKey=PNLNOOURNGVKGL-SNVBAGLBSA-N
SMILES:[C@H](CC(OC)=O)(N)C1=CC=C(C)C=C1
Synonyms:- Methyl (βR)-β-amino-4-methylbenzenepropanoate
- Benzenepropanoic acid, β-amino-4-methyl-, methyl ester, (βR)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.