
CAS 121365-23-9
:(5E)-6-(4-Bromophenyl)-4-oxo-5-hexenoic acid
Description:
(5E)-6-(4-Bromophenyl)-4-oxo-5-hexenoic acid is an organic compound characterized by its unique structure, which includes a hexenoic acid backbone with a bromophenyl substituent. The presence of the bromine atom introduces significant electronegativity, influencing the compound's reactivity and potential applications in organic synthesis. The compound features a conjugated system due to the double bond in the hexenoic chain, which can enhance its stability and reactivity in various chemical reactions, such as electrophilic additions or polymerizations. The keto group (4-oxo) contributes to the compound's acidity and can participate in tautomeric equilibria. This compound may exhibit biological activity, making it of interest in pharmaceutical research. Its solubility and stability in different solvents can vary, affecting its practical applications. Overall, (5E)-6-(4-Bromophenyl)-4-oxo-5-hexenoic acid is a versatile compound with potential uses in medicinal chemistry and materials science, warranting further investigation into its properties and applications.
Formula:C12H11BrO3
InChI:InChI=1S/C12H11BrO3/c13-10-4-1-9(2-5-10)3-6-11(14)7-8-12(15)16/h1-6H,7-8H2,(H,15,16)/b6-3+
InChI key:InChIKey=QIFUPUVQSHKIAA-ZZXKWVIFSA-N
SMILES:C(=C/C(CCC(O)=O)=O)\C1=CC=C(Br)C=C1
Synonyms:- 5-Hexenoic acid, 6-(4-bromophenyl)-4-oxo-, (E)-
- 5-Hexenoic acid, 6-(4-bromophenyl)-4-oxo-, (5E)-
- (5E)-6-(4-Bromophenyl)-4-oxo-5-hexenoic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.