CAS 1213843-65-2

(αR,βR)-β-Amino-2-fluoro-α-methyl-3-(trifluoromethyl)benzeneethanol

Description:

(αR,βR)-β-Amino-2-fluoro-α-methyl-3-(trifluoromethyl)benzeneethanol, with CAS number 1213843-65-2, is a chemical compound characterized by its unique structural features, including a fluorine atom and a trifluoromethyl group attached to a benzene ring. The presence of the amino group indicates that it can participate in hydrogen bonding, which may influence its solubility and reactivity. The stereochemistry denoted by (αR,βR) suggests specific spatial arrangements of its atoms, which can significantly affect its biological activity and interaction with other molecules. This compound may exhibit properties typical of both amines and alcohols, such as potential basicity and the ability to form esters or ethers. Its trifluoromethyl group often imparts unique electronic properties, enhancing lipophilicity and potentially influencing pharmacokinetics if the compound is considered for medicinal applications. Overall, the combination of these functional groups and stereochemical configurations makes this compound of interest in various fields, including pharmaceuticals and materials science.

Formula: C₁₀H₁₁F₄NO

InChI: InChI=1S/C10H11F4NO/c1-5(16)9(15)6-3-2-4-7(8(6)11)10(12,13)14/h2-5,9,16H,15H2,1H3/t5-,9+/m1/s1

InChI key: InChIKey=CFIHNRLLYRAXQL-ANLVUFKYSA-N

SMILES: [C@@H]([C@@H](C)O)(N)C1=C(F)C(C(F)(F)F)=CC=C1

Synonyms:

• Benzeneethanol, β-amino-2-fluoro-α-methyl-3-(trifluoromethyl)-, (αR,βR)-
• (αR,βR)-β-Amino-2-fluoro-α-methyl-3-(trifluoromethyl)benzeneethanol
• (1R,2R)-1-AMINO-1-[2-FLUORO-3-(TRIFLUOROMETHYL)PHENYL]PROPAN-2-OL