CymitQuimica logo

CAS 1213884-96-8

:

(αS)-3-Bromo-α-(trifluoromethyl)-4-pyridinemethanamine

Description:
(αS)-3-Bromo-α-(trifluoromethyl)-4-pyridinemethanamine is a chemical compound characterized by its unique structural features, including a pyridine ring and a trifluoromethyl group. The presence of the bromine atom and the trifluoromethyl group contributes to its reactivity and potential applications in medicinal chemistry and material science. This compound is likely to exhibit polar characteristics due to the electronegative fluorine atoms, which can influence its solubility and interaction with biological targets. The specific stereochemistry indicated by the (αS) designation suggests that it has a defined spatial arrangement, which can significantly affect its biological activity and pharmacokinetics. Additionally, the compound may participate in various chemical reactions, such as nucleophilic substitutions or coupling reactions, making it a valuable intermediate in synthetic organic chemistry. Its CAS number, 1213884-96-8, allows for precise identification and retrieval of information regarding its properties, safety data, and regulatory status in chemical databases.
Formula:C7H6BrF3N2
InChI:InChI=1S/C7H6BrF3N2/c8-5-3-13-2-1-4(5)6(12)7(9,10)11/h1-3,6H,12H2/t6-/m0/s1
InChI key:InChIKey=ZIFIMGPYLRYYGP-LURJTMIESA-N
SMILES:[C@H](C(F)(F)F)(N)C=1C(Br)=CN=CC1
Synonyms:
  • 4-Pyridinemethanamine, 3-bromo-α-(trifluoromethyl)-, (αS)-
  • (αS)-3-Bromo-α-(trifluoromethyl)-4-pyridinemethanamine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.