CAS 1213918-01-4

(βS)-β-Amino-3-fluoro-4-(trifluoromethyl)benzeneethanol

Description:

(βS)-β-Amino-3-fluoro-4-(trifluoromethyl)benzeneethanol is a chemical compound characterized by its unique structural features, including a β-amino group and a trifluoromethyl substituent on a benzene ring. The presence of the fluorine atoms contributes to its hydrophobic properties and can influence its reactivity and interaction with biological systems. This compound is likely to exhibit polar characteristics due to the hydroxyl (-OH) group, which can engage in hydrogen bonding. The stereochemistry indicated by the (βS) designation suggests a specific spatial arrangement of atoms, which can significantly affect the compound's biological activity and pharmacological properties. Such compounds are often of interest in medicinal chemistry for their potential applications in drug development, particularly in targeting specific biological pathways. Additionally, the trifluoromethyl group is known to enhance metabolic stability and lipophilicity, making this compound a candidate for further research in various chemical and pharmaceutical contexts.

Formula: C₉H₉F₄NO

InChI: InChI=1S/C9H9F4NO/c10-7-3-5(8(14)4-15)1-2-6(7)9(11,12)13/h1-3,8,15H,4,14H2/t8-/m1/s1

InChI key: InChIKey=RHPCYPZQMMYPPR-MRVPVSSYSA-N

SMILES: [C@H](CO)(N)C1=CC(F)=C(C(F)(F)F)C=C1

Synonyms:

• (βS)-β-Amino-3-fluoro-4-(trifluoromethyl)benzeneethanol
• Benzeneethanol, β-amino-3-fluoro-4-(trifluoromethyl)-, (βS)-