CymitQuimica logo

CAS 1213955-04-4

:

(1R)-1-(3-Fluoro-4-methylphenyl)-1,2-ethanediamine

Description:
(1R)-1-(3-Fluoro-4-methylphenyl)-1,2-ethanediamine is an organic compound characterized by its amine functional groups and a substituted aromatic ring. The presence of a fluorine atom and a methyl group on the aromatic ring contributes to its unique chemical properties, including potential variations in polarity and reactivity. This compound features a chiral center, indicated by the (1R) designation, which can influence its biological activity and interactions with other molecules. The ethylenediamine backbone provides two amine functionalities, which can participate in hydrogen bonding and coordination with metal ions. Its molecular structure suggests potential applications in pharmaceuticals, particularly in the development of drugs targeting specific biological pathways. Additionally, the compound's solubility and stability can be influenced by the substituents on the aromatic ring, making it a subject of interest in medicinal chemistry and material science. Overall, (1R)-1-(3-Fluoro-4-methylphenyl)-1,2-ethanediamine exemplifies the complexity and versatility of amine-containing compounds in various chemical contexts.
Formula:C9H13FN2
InChI:InChI=1S/C9H13FN2/c1-6-2-3-7(4-8(6)10)9(12)5-11/h2-4,9H,5,11-12H2,1H3/t9-/m0/s1
InChI key:InChIKey=AZWZWUKMKCZLQC-VIFPVBQESA-N
SMILES:[C@@H](CN)(N)C1=CC(F)=C(C)C=C1
Synonyms:
  • (1R)-1-(3-Fluoro-4-methylphenyl)-1,2-ethanediamine
  • 1,2-Ethanediamine, 1-(3-fluoro-4-methylphenyl)-, (1R)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.