CAS 1213960-29-2

(1R)-1-[4-(Trifluoromethoxy)phenyl]-1,2-ethanediamine

Description:

(1R)-1-[4-(Trifluoromethoxy)phenyl]-1,2-ethanediamine is a chemical compound characterized by its specific stereochemistry and functional groups. It features a chiral center, which contributes to its potential biological activity and interaction with biological systems. The presence of the trifluoromethoxy group enhances its lipophilicity and may influence its pharmacokinetic properties, making it of interest in medicinal chemistry. The compound contains an ethanediamine backbone, which suggests it may participate in hydrogen bonding and other interactions due to the amine functional groups. This structure can lead to various applications, particularly in the development of pharmaceuticals or agrochemicals. The trifluoromethoxy substituent is known for its electron-withdrawing properties, which can affect the reactivity and stability of the compound. Overall, the unique combination of its functional groups and stereochemistry makes (1R)-1-[4-(Trifluoromethoxy)phenyl]-1,2-ethanediamine a compound of interest for further research and potential applications in various fields.

Formula: C₉H₁₁F₃N₂O

InChI: InChI=1S/C9H11F3N2O/c10-9(11,12)15-7-3-1-6(2-4-7)8(14)5-13/h1-4,8H,5,13-14H2/t8-/m0/s1

InChI key: InChIKey=HSMPCGOCWQZZEB-QMMMGPOBSA-N

SMILES: O(C(F)(F)F)C1=CC=C([C@H](CN)N)C=C1

Synonyms:

• 1,2-Ethanediamine, 1-[4-(trifluoromethoxy)phenyl]-, (1R)-
• (1R)-1-[4-(Trifluoromethoxy)phenyl]-1,2-ethanediamine