CAS 1213977-07-1

4-[(1S)-1-Amino-2-propen-1-yl]phenol

Description:

4-[(1S)-1-Amino-2-propen-1-yl]phenol, also known by its CAS number 1213977-07-1, is an organic compound characterized by the presence of both an amino group and a phenolic hydroxyl group. This compound features a phenol ring substituted with a propenyl group that contains an amino functional group, which contributes to its potential reactivity and biological activity. The stereochemistry indicated by the (1S) designation suggests that the amino group is attached to a chiral center, influencing the compound's interactions in biological systems. Typically, compounds of this nature may exhibit properties such as antioxidant activity, and they could be of interest in pharmaceutical applications due to their potential role in modulating biological pathways. Additionally, the presence of both hydrophilic (hydroxyl and amino groups) and hydrophobic (phenyl ring) regions in the molecule may affect its solubility and interaction with other biomolecules. Overall, 4-[(1S)-1-Amino-2-propen-1-yl]phenol represents a class of compounds that may have significant implications in medicinal chemistry and biochemistry.

Formula: C₉H₁₁NO

InChI: InChI=1S/C9H11NO/c1-2-9(10)7-3-5-8(11)6-4-7/h2-6,9,11H,1,10H2/t9-/m0/s1

InChI key: InChIKey=YVLLLFDQHSKYMV-VIFPVBQESA-N

SMILES: [C@@H](C=C)(N)C1=CC=C(O)C=C1

Synonyms:

• 4-[(1S)-1-Amino-2-propen-1-yl]phenol
• Phenol, 4-[(1S)-1-amino-2-propen-1-yl]-