CAS 1214-16-0: 3,6-DIBROMO-9-VINYLCARBAZOLE
Description:3,6-Dibromo-9-vinylcarbazole is an organic compound characterized by its structure, which includes a carbazole core substituted with bromine atoms at the 3 and 6 positions and a vinyl group at the 9 position. This compound is typically a solid at room temperature and exhibits a range of physical properties influenced by its halogenated and unsaturated nature. It is known for its potential applications in organic electronics, particularly in the development of light-emitting diodes (LEDs) and photovoltaic devices, due to its ability to participate in charge transfer processes. The presence of bromine enhances its reactivity and can facilitate further chemical modifications. Additionally, the vinyl group contributes to its polymerization potential, making it useful in creating polymeric materials with specific electronic properties. Safety considerations should be taken into account when handling this compound, as brominated compounds can pose environmental and health risks. Overall, 3,6-dibromo-9-vinylcarbazole is a significant compound in materials science and organic chemistry research.
Formula:C14H9Br2N
InChI:InChI=1S/C14H9Br2N/c1-2-17-13-5-3-9(15)7-11(13)12-8-10(16)4-6-14(12)17/h2-8H,1H2
InChI key:InChIKey=ORMIJZCMQBMNFA-UHFFFAOYSA-N
SMILES:BrC1=CC=C2C(=C1)C=3C=C(Br)C=CC3N2C=C
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | 3,6-Dibromo-9-vinyl-9H-carbazole REF: 3B-D5426CAS: 1214-16-0 | >98.0%(GC) | 136.00 € | Mon 07 Apr 25 |
![]() | 3,6-Dibromo-9-Vinyl-9H-Carbazole REF: 54-OR1010834CAS: 1214-16-0 | 98% | 34.00 €~930.00 € | Tue 15 Apr 25 |
![]() | 3,6-Dibromo-9-vinylcarbazole REF: 3D-FD152039CAS: 1214-16-0 | Min. 95% | - - - | Discontinued product |

3,6-Dibromo-9-vinyl-9H-carbazole
Ref: 3B-D5426
1g | 136.00 € |

Ref: 54-OR1010834
1g | 78.00 € | ||
5g | 245.00 € | ||
25g | 930.00 € | ||
250mg | 34.00 € |

3,6-Dibromo-9-vinylcarbazole
Ref: 3D-FD152039
2mg | Discontinued | Request information | |
5mg | Discontinued | Request information | |
10mg | Discontinued | Request information | |
25mg | Discontinued | Request information | |
50mg | Discontinued | Request information |