CAS 1214-75-1
:(N N-DIMETHYLAMINO)ETHENYL-2 4-DINITROB&
Description:
(N,N-Dimethylamino)ethenyl-2,4-dinitrobenzene, identified by the CAS number 1214-75-1, is an organic compound characterized by its dinitrobenzene structure and a dimethylamino group. This compound typically exhibits a yellow to orange color due to the presence of the dinitro groups, which are known to impart strong electron-withdrawing properties. It is likely to be a solid at room temperature and may have a relatively low solubility in water, while being more soluble in organic solvents. The presence of the dimethylamino group suggests that it may exhibit basic properties, potentially allowing it to participate in various chemical reactions, including nucleophilic substitutions. Additionally, the dinitro groups can enhance the compound's reactivity, making it useful in synthetic applications, particularly in the field of dyes and pigments. However, due to the presence of nitro groups, it may also pose environmental and health risks, necessitating careful handling and disposal. Always consult safety data sheets and regulatory guidelines when working with such compounds.
Formula:C10H11N3O4
InChI:InChI=1/C10H11N3O4/c1-11(2)6-5-8-3-4-9(12(14)15)7-10(8)13(16)17/h3-7H,1-2H3/b6-5+
Synonyms:- ethenamine, 2-(2,4-dinitrophenyl)-N,N-dimethyl-, (E)-
- (E)-2-(2,4-dinitrophenyl)-N,N-dimethylethenamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.