
CAS 121412-39-3
:1,2-Naphthalenediol, 4-(cyclohexylmethylamino)-, 1,2-diacetate
Description:
1,2-Naphthalenediol, 4-(cyclohexylmethylamino)-, 1,2-diacetate, identified by its CAS number 121412-39-3, is a chemical compound that features a naphthalene backbone substituted with hydroxyl groups and an amino group. This compound is characterized by its diacetate functional groups, which enhance its solubility and reactivity. The presence of the cyclohexylmethylamino moiety suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the structural diversity it introduces. The hydroxyl groups contribute to its potential as a hydrogen bond donor, influencing its interactions in biological systems. Additionally, the compound may exhibit interesting optical properties due to the naphthalene structure, which can be relevant in various applications, including organic electronics and dyes. Overall, the unique combination of functional groups in this compound suggests a range of potential applications, particularly in the fields of organic synthesis and drug development.
Formula:C21H25NO4
InChI:InChI=1S/C21H25NO4/c1-14(23)25-20-13-19(22(3)16-9-5-4-6-10-16)17-11-7-8-12-18(17)21(20)26-15(2)24/h7-8,11-13,16H,4-6,9-10H2,1-3H3
InChI key:InChIKey=DABSYCZQZRNORX-UHFFFAOYSA-N
SMILES:O(C(C)=O)C=1C2=C(C(N(C)C3CCCCC3)=CC1OC(C)=O)C=CC=C2
Synonyms:- CGS 21595
- 1,2-Naphthalenediol, 4-(cyclohexylmethylamino)-, diacetate (ester)
- 1,2-Naphthalenediol, 4-(cyclohexylmethylamino)-, 1,2-diacetate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
CGS 21595
CAS:CGS 21595 inhibits the formation of 5-hydroxyeicosatetraenoic acid and leukotriene B4; rapidly metabolized to CGS 19213.Formula:C21H25NO4Color and Shape:SolidMolecular weight:355.43
