CAS 1214189-75-9

Benzeneacetic acid, α-amino-2-chloro-6-fluoro-, ethanedioate (1:1)

Description:

Benzeneacetic acid, α-amino-2-chloro-6-fluoro-, ethanedioate (1:1), with the CAS number 1214189-75-9, is a chemical compound characterized by its complex structure that includes a benzene ring, an amino group, and halogen substituents. This compound features a chloro and a fluoro group, which contribute to its reactivity and potential biological activity. The presence of the ethanedioate moiety indicates that it forms a salt or ester with ethanoic acid, enhancing its solubility and stability in various solvents. The amino group suggests potential for interactions in biological systems, making it of interest in pharmaceutical applications. Its unique combination of functional groups may impart specific properties such as acidity, polarity, and the ability to participate in hydrogen bonding. Overall, this compound's characteristics make it a subject of interest in both synthetic chemistry and medicinal chemistry, particularly in the development of new therapeutic agents. However, detailed studies would be necessary to fully understand its behavior and applications.

Formula: C₈H₇ClFNO₂·C₂H₂O₄

InChI: InChI=1S/C8H7ClFNO2.C2H2O4/c9-4-2-1-3-5(10)6(4)7(11)8(12)13;3-1(4)2(5)6/h1-3,7H,11H2,(H,12,13);(H,3,4)(H,5,6)

InChI key: InChIKey=YRBUHLWQGMSDQZ-UHFFFAOYSA-N

SMILES: C(C(O)=O)(N)C1=C(Cl)C=CC=C1F.C(C(O)=O)(O)=O

Synonyms:

• Benzeneacetic acid, α-amino-2-chloro-6-fluoro-, ethanedioate (1:1)