CAS 1214265-56-1

N-{3-[(5-Chloro-2-{[4-(4-methyl-1-piperazinyl)phenyl]amino}-4-pyrimidinyl)oxy]phenyl}acrylamide

Description:

N-{3-[(5-Chloro-2-{[4-(4-methyl-1-piperazinyl)phenyl]amino}-4-pyrimidinyl)oxy]phenyl}acrylamide, with the CAS number 1214265-56-1, is a synthetic organic compound characterized by its complex structure, which includes multiple functional groups such as an acrylamide moiety and a chlorinated pyrimidine derivative. This compound features a piperazine ring, which is known for its biological activity and ability to interact with various receptors. The presence of the chloro and amino groups suggests potential reactivity and the ability to form hydrogen bonds, which may enhance its solubility and interaction with biological targets. Typically, compounds of this nature are investigated for their pharmacological properties, particularly in the context of medicinal chemistry, where they may exhibit antitumor or antimicrobial activities. The intricate arrangement of substituents indicates that this compound could be a candidate for further research in drug development, particularly in targeting specific pathways or receptors in disease models. As with many synthetic compounds, safety and handling precautions are essential due to potential toxicity or reactivity.

Formula: C₂₄H₂₅ClN₆O₂

InChI: InChI=1S/C24H25ClN6O2/c1-3-22(32)27-18-5-4-6-20(15-18)33-23-21(25)16-26-24(29-23)28-17-7-9-19(10-8-17)31-13-11-30(2)12-14-31/h3-10,15-16H,1,11-14H2,2H3,(H,27,32)(H,26,28,29)

SMILES: C=CC(=Nc1cccc(c1)Oc1c(cnc(Nc2ccc(cc2)N2CCN(C)CC2)n1)Cl)O

Synonyms:

• Wz3146
• Wz-3146

WZ3146

CAS: 1214265-56-1

Formula: C₂₄H₂₅ClN₆O₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 464.9473

Ref: IN-DA009CFN

WZ-3146

CAS: 1214265-56-1

WZ-3146

Purity: ≥95%

Molecular weight: 464.95g/mol

Ref: 54-BUP02834

WZ-3146

CAS: 1214265-56-1

WZ3146: EGFR(L858R/E746_A750) inhibitor, IC50=2 nM, selective, doesn't block ERBB2(T798I).

Formula: C₂₄H₂₅ClN₆O₂

Purity: 97.15%

Color and Shape: Solid

Molecular weight: 464.95

Ref: TM-T6733