CAS 121428-73-7

2-[(Ethoxycarbonyl)amino]butanoic acid

Description:

2-[(Ethoxycarbonyl)amino]butanoic acid, also known by its CAS number 121428-73-7, is an amino acid derivative characterized by the presence of both an amino group and a carboxylic acid group, making it a member of the α-amino acid family. This compound features an ethoxycarbonyl group, which contributes to its unique reactivity and solubility properties. Typically, it appears as a white to off-white solid and is soluble in polar solvents due to the presence of the carboxylic acid and amino functionalities. The ethoxycarbonyl group enhances its stability and can influence its biological activity, making it of interest in pharmaceutical and biochemical research. The compound's structure allows for potential applications in peptide synthesis and as a building block in drug development. Additionally, its properties may be influenced by factors such as pH and temperature, which can affect its ionization state and overall reactivity.

Formula: C₇H₁₃NO₄

InChI: InChI=1S/C7H13NO4/c1-3-5(6(9)10)8-7(11)12-4-2/h5H,3-4H2,1-2H3,(H,8,11)(H,9,10)

InChI key: InChIKey=IKUZTBFNEUVANS-UHFFFAOYSA-N

SMILES: C(NC(OCC)=O)(C(O)=O)CC

Synonyms:

• 2-[(Ethoxycarbonyl)amino]butanoic acid
• Butanoic acid, 2-[(ethoxycarbonyl)amino]-, (±)-
• Butanoic acid, 2-[(ethoxycarbonyl)amino]-