
CAS 1214323-05-3
:3-Chloro-2-methoxy-6-(trifluoromethyl)pyridine
Description:
3-Chloro-2-methoxy-6-(trifluoromethyl)pyridine is a heterocyclic organic compound characterized by its pyridine ring, which is a six-membered aromatic ring containing one nitrogen atom. The presence of a chlorine atom at the 3-position and a methoxy group at the 2-position contributes to its reactivity and solubility properties. The trifluoromethyl group at the 6-position significantly enhances the compound's lipophilicity and can influence its biological activity, making it of interest in medicinal chemistry and agrochemical applications. This compound is typically a colorless to pale yellow liquid or solid, depending on its purity and form. It is important to handle it with care due to potential toxicity and environmental impact. The molecular structure allows for various substitution reactions, making it a versatile intermediate in organic synthesis. Its unique combination of functional groups may impart specific pharmacological properties, making it a candidate for further research in drug development or as a building block in the synthesis of more complex molecules.
Formula:C7H5ClF3NO
InChI:InChI=1S/C7H5ClF3NO/c1-13-6-4(8)2-3-5(12-6)7(9,10)11/h2-3H,1H3
InChI key:InChIKey=ICMSUMGQLYZWLM-UHFFFAOYSA-N
SMILES:C(F)(F)(F)C=1N=C(OC)C(Cl)=CC1
Synonyms:- Pyridine, 3-chloro-2-methoxy-6-(trifluoromethyl)-
- 3-Chloro-2-methoxy-6-(trifluoromethyl)pyridine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.