CAS 1214323-21-3

4-Fluoro-α-hydroxy-3-(trifluoromethyl)benzeneacetic acid

Description:

4-Fluoro-α-hydroxy-3-(trifluoromethyl)benzeneacetic acid, identified by its CAS number 1214323-21-3, is a chemical compound characterized by the presence of a fluorine atom and a trifluoromethyl group attached to a benzene ring. This compound features a carboxylic acid functional group, which contributes to its acidity and potential reactivity. The presence of the α-hydroxy group indicates that it has alcohol characteristics, which can influence its solubility and interaction with other molecules. The trifluoromethyl group is known for imparting unique electronic properties, enhancing lipophilicity, and affecting the compound's biological activity. Overall, this compound may exhibit interesting pharmacological properties, making it of interest in medicinal chemistry and drug development. Its specific characteristics, such as melting point, boiling point, and solubility, would depend on its molecular structure and interactions with solvents. As with many fluorinated compounds, it may also exhibit stability under various conditions, making it suitable for diverse applications in research and industry.

Formula: C₉H₆F₄O₃

InChI: InChI=1S/C9H6F4O3/c10-6-2-1-4(7(14)8(15)16)3-5(6)9(11,12)13/h1-3,7,14H,(H,15,16)

InChI key: InChIKey=XKSUFCHGDGWBOQ-UHFFFAOYSA-N

SMILES: C(F)(F)(F)C1=CC(C(C(O)=O)O)=CC=C1F

Synonyms:

• 4-Fluoro-α-hydroxy-3-(trifluoromethyl)benzeneacetic acid
• Benzeneacetic acid, 4-fluoro-α-hydroxy-3-(trifluoromethyl)-
• 2-[4-Fluoro-3-(trifluoromethyl)phenyl]-2-hydroxyacetic acid