CymitQuimica logo

CAS 1214323-41-7

:

2-Fluoro-3-methoxy-1,1′-biphenyl

Description:
2-Fluoro-3-methoxy-1,1'-biphenyl is an organic compound characterized by the presence of a biphenyl structure, which consists of two phenyl rings connected by a single bond. The compound features a fluorine atom at the second position and a methoxy group (-OCH3) at the third position of one of the phenyl rings. This substitution pattern influences its chemical properties, including its reactivity and polarity. The presence of the fluorine atom typically enhances the compound's electronegativity, potentially affecting its interactions with other molecules. The methoxy group can act as an electron-donating group, which may stabilize certain reactive intermediates. 2-Fluoro-3-methoxy-1,1'-biphenyl may be utilized in various applications, including organic synthesis and materials science, due to its unique electronic properties. Additionally, its structural characteristics may make it of interest in the development of pharmaceuticals or agrochemicals, where specific functional groups can play a crucial role in biological activity. As with many organic compounds, safety and handling precautions should be observed due to potential toxicity or environmental impact.
Formula:C13H11FO
InChI:InChI=1S/C13H11FO/c1-15-12-9-5-8-11(13(12)14)10-6-3-2-4-7-10/h2-9H,1H3
InChI key:InChIKey=VARNVZNSCHNTJI-UHFFFAOYSA-N
SMILES:FC1=C(C=CC=C1OC)C2=CC=CC=C2
Synonyms:
  • 2-Fluoro-3-methoxy-1,1′-biphenyl
  • 1,1′-Biphenyl, 2-fluoro-3-methoxy-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.