CAS 1214323-87-1
:Pyridine, 3-nitro-5-(trifluoromethyl)-
Description:
Pyridine, 3-nitro-5-(trifluoromethyl)- is a heterocyclic aromatic compound characterized by a pyridine ring substituted with a nitro group and a trifluoromethyl group. The presence of the nitro group introduces significant polarity and can enhance the compound's reactivity, particularly in electrophilic aromatic substitution reactions. The trifluoromethyl group is known for its electron-withdrawing properties, which can influence the electronic distribution within the molecule, affecting its chemical behavior and stability. This compound is typically colorless to pale yellow and may exhibit a distinctive odor. It is soluble in organic solvents and may have limited solubility in water. Due to its functional groups, it may be utilized in various applications, including pharmaceuticals, agrochemicals, and materials science. Safety data should be consulted, as compounds with nitro and trifluoromethyl groups can pose health and environmental risks. Overall, the unique combination of functional groups in this pyridine derivative contributes to its potential utility in synthetic chemistry and industrial applications.
Formula:C6H3F3N2O2
InChI:InChI=1S/C6H3F3N2O2/c7-6(8,9)4-1-5(11(12)13)3-10-2-4/h1-3H
InChI key:InChIKey=QHTGFPIKZWZGRJ-UHFFFAOYSA-N
SMILES:C(F)(F)(F)C=1C=C(N(=O)=O)C=NC1
Synonyms:- 3-Nitro-5-(trifluoromethyl)pyridine
- Pyridine, 3-nitro-5-(trifluoromethyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
