
CAS 1214323-95-1
:6-Methyl[2,3′-bipyridin]-3-amine
Description:
6-Methyl[2,3′-bipyridin]-3-amine is an organic compound characterized by its bipyridine structure, which consists of two pyridine rings connected by a carbon-carbon bond. The presence of a methyl group at the 6-position and an amino group at the 3-position contributes to its unique chemical properties. This compound is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the amino group, which can engage in hydrogen bonding. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, as bipyridine derivatives are often explored for their biological activity. Additionally, the compound may participate in various chemical reactions, including nucleophilic substitutions and coordination with metal ions, making it of interest in coordination chemistry. Safety data and handling precautions should be considered, as with any chemical substance, to ensure proper laboratory practices.
Formula:C11H11N3
InChI:InChI=1S/C11H11N3/c1-8-4-5-10(12)11(14-8)9-3-2-6-13-7-9/h2-7H,12H2,1H3
InChI key:InChIKey=VXYILYPNGPZHJE-UHFFFAOYSA-N
SMILES:NC1=C(N=C(C)C=C1)C=2C=CC=NC2
Synonyms:- 6-Methyl[2,3′-bipyridin]-3-amine
- [2,3′-Bipyridin]-3-amine, 6-methyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.