CymitQuimica logo

CAS 1214326-94-9

:

pyridine, 2-bromo-3-chloro-5-fluoro-

Description:
Pyridine, 2-bromo-3-chloro-5-fluoro- is a halogenated derivative of pyridine, characterized by the presence of bromine, chlorine, and fluorine substituents on the pyridine ring. This compound typically exhibits a colorless to pale yellow appearance and possesses a distinctive aromatic odor. The presence of halogens can influence its reactivity, making it a potential candidate for various chemical reactions, including nucleophilic substitutions and coupling reactions. Its molecular structure contributes to its polar nature, which can affect its solubility in organic solvents and water. Additionally, the compound may exhibit biological activity, making it of interest in pharmaceutical research. Safety considerations are important, as halogenated compounds can be toxic or hazardous. Proper handling and storage protocols should be followed to mitigate risks associated with exposure. Overall, pyridine, 2-bromo-3-chloro-5-fluoro- is a versatile compound with applications in organic synthesis and potential implications in medicinal chemistry.
Formula:C5H2BrClFN
InChI:InChI=1S/C5H2BrClFN/c6-5-4(7)1-3(8)2-9-5/h1-2H
InChI key:NWCUOFUVPZPBKW-UHFFFAOYSA-N
SMILES:c1c(cnc(c1Cl)Br)F
Synonyms:
  • 2-Bromo-3-chloro-5-fluoropyridine
Found 4 products.