
CAS 1214327-82-8
:5-(4-Fluorophenyl)-1,6-dihydro-6-oxo-3-pyridinecarboxylic acid
Description:
5-(4-Fluorophenyl)-1,6-dihydro-6-oxo-3-pyridinecarboxylic acid is a chemical compound characterized by its pyridine ring structure, which is substituted with a 4-fluorophenyl group and a carboxylic acid functional group. The presence of the fluorine atom enhances the compound's lipophilicity and may influence its biological activity. The dihydro and keto functionalities contribute to its reactivity and potential interactions in various chemical environments. This compound may exhibit properties typical of pyridine derivatives, such as being a weak acid due to the carboxylic acid group. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, as many pyridine derivatives are known for their biological activities. Additionally, the compound's unique substituents may provide opportunities for further functionalization or modification, making it a subject of interest in synthetic organic chemistry. As with many chemical substances, safety and handling precautions should be observed, particularly due to the presence of the fluorine atom, which can impart specific toxicological properties.
Formula:C12H8FNO3
InChI:InChI=1S/C12H8FNO3/c13-9-3-1-7(2-4-9)10-5-8(12(16)17)6-14-11(10)15/h1-6H,(H,14,15)(H,16,17)
InChI key:InChIKey=WUGYRKBZUQMFKU-UHFFFAOYSA-N
SMILES:O=C1C(=CC(C(O)=O)=CN1)C2=CC=C(F)C=C2
Synonyms:- 5-(4-Fluorophenyl)-1,6-dihydro-6-oxo-3-pyridinecarboxylic acid
- 3-Pyridinecarboxylic acid, 5-(4-fluorophenyl)-1,6-dihydro-6-oxo-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.