CAS 1214328-20-7

2-Fluoro-3-nitrobenzonitrile

Description:

2-Fluoro-3-nitrobenzonitrile is an organic compound characterized by the presence of a fluorine atom, a nitro group, and a cyano group attached to a benzene ring. The molecular structure features a fluorine substituent at the ortho position and a nitro group at the meta position relative to the cyano group. This compound is typically a crystalline solid and is known for its potential applications in pharmaceuticals and agrochemicals due to its reactivity and ability to participate in various chemical reactions. The presence of both the nitro and cyano groups contributes to its electrophilic properties, making it a useful intermediate in organic synthesis. Additionally, 2-Fluoro-3-nitrobenzonitrile may exhibit specific solubility characteristics in organic solvents, and its reactivity can be influenced by the electron-withdrawing nature of the nitro and cyano groups. Safety data sheets should be consulted for handling and storage guidelines, as with many nitro compounds, it may pose health and environmental risks.

Formula: C₇H₃FN₂O₂

InChI: InChI=1S/C7H3FN2O2/c8-7-5(4-9)2-1-3-6(7)10(11)12/h1-3H

SMILES: c1cc(C#N)c(c(c1)N(=O)=O)F

Benzonitrile, 2-fluoro-3-nitro-

CAS: 1214328-20-7

Formula: C₇H₃FN₂O₂

Purity: 95%

Color and Shape: Solid

Molecular weight: 166.1093

Ref: IN-DA0014RK

2-Fluoro-3-nitrobenzonitrile

CAS: 1214328-20-7

2-Fluoro-3-nitrobenzonitrile

Formula: C₇H₃FN₂O₂

Purity: ≥95%

Color and Shape: faint yellow to light yellow solid

Molecular weight: 166.11g/mol

Ref: 54-PC53131

2-Fluoro-3-Nitrobenzonitrile

CAS: 1214328-20-7

Formula: C₇H₃FN₂O₂

Molecular weight: 166.11

Ref: 4Z-B-139213

2-Fluoro-3-nitrobenzonitrile

CAS: 1214328-20-7

Formula: C₇H₃FN₂O₂

Purity: 95%

Color and Shape: Brown powder

Molecular weight: 166.111

Ref: 10-F235138