CymitQuimica logo

CAS 1214328-84-3

:

Methyl 5-bromo-3-(trifluoromethyl)-2-pyridinecarboxylate

Description:
Methyl 5-bromo-3-(trifluoromethyl)-2-pyridinecarboxylate is an organic compound characterized by its pyridine ring, which is a six-membered aromatic heterocycle containing one nitrogen atom. This compound features a bromine atom and a trifluoromethyl group (-CF3) as substituents on the pyridine ring, contributing to its unique reactivity and properties. The presence of the carboxylate functional group, specifically as a methyl ester, indicates that it can undergo hydrolysis to form the corresponding carboxylic acid. The trifluoromethyl group is known for enhancing the lipophilicity and metabolic stability of compounds, making them of interest in medicinal chemistry. Additionally, the bromine atom can serve as a site for further chemical modifications, such as nucleophilic substitution reactions. Overall, this compound is likely to exhibit interesting biological activities and may be utilized in various synthetic applications, particularly in the development of pharmaceuticals and agrochemicals. Its specific characteristics, such as solubility and stability, would depend on the conditions under which it is handled.
Formula:C8H5BrF3NO2
InChI:InChI=1S/C8H5BrF3NO2/c1-15-7(14)6-5(8(10,11)12)2-4(9)3-13-6/h2-3H,1H3
InChI key:YRYMNZJJAFOWHH-UHFFFAOYSA-N
SMILES:COC(=O)C1=C(C=C(C=N1)Br)C(F)(F)F
Found 4 products.