CAS 1214329-18-6

2-Fluoro[1,1′-biphenyl]-3-carbonyl chloride

Description:

2-Fluoro[1,1′-biphenyl]-3-carbonyl chloride, with the CAS number 1214329-18-6, is an organic compound characterized by the presence of a biphenyl structure substituted with a fluorine atom and a carbonyl chloride functional group. This compound features a fluorine atom at the second position of the biphenyl moiety, which can influence its reactivity and physical properties, such as polarity and boiling point. The carbonyl chloride group, also known as an acyl chloride, is known for its high reactivity, particularly in nucleophilic acyl substitution reactions, making it useful in organic synthesis. The presence of both the fluorine and the carbonyl chloride groups suggests potential applications in the synthesis of pharmaceuticals or agrochemicals, where such functionalities are often desirable. Additionally, the compound's stability and reactivity can be influenced by factors such as temperature and the presence of solvents. Overall, 2-Fluoro[1,1′-biphenyl]-3-carbonyl chloride is a valuable compound in synthetic organic chemistry due to its unique structural features.

Formula: C₁₃H₈ClFO

InChI: InChI=1S/C13H8ClFO/c14-13(16)11-8-4-7-10(12(11)15)9-5-2-1-3-6-9/h1-8H

InChI key: InChIKey=YZNCRUCUUUVUIX-UHFFFAOYSA-N

SMILES: FC1=C(C=CC=C1C(Cl)=O)C2=CC=CC=C2

Synonyms:

• 2-Fluoro[1,1′-biphenyl]-3-carbonyl chloride
• [1,1′-Biphenyl]-3-carbonyl chloride, 2-fluoro-