CAS 1214330-80-9

4′,5-Difluoro[1,1′-biphenyl]-3-carboxylic acid

Description:

4′,5-Difluoro[1,1′-biphenyl]-3-carboxylic acid is an organic compound characterized by the presence of two fluorine atoms and a carboxylic acid functional group attached to a biphenyl structure. The biphenyl moiety consists of two phenyl rings connected by a single bond, which allows for rotational freedom, influencing its physical properties. The difluorination at the 4' and 5' positions introduces significant electronegativity, potentially affecting the compound's reactivity and interaction with other molecules. The carboxylic acid group (-COOH) contributes to its acidity and solubility in polar solvents, making it useful in various chemical reactions and applications. This compound may exhibit interesting properties such as altered melting and boiling points compared to its non-fluorinated counterparts, and it could serve as a building block in the synthesis of more complex organic molecules or materials. Its unique structure and functional groups may also impart specific biological or pharmacological activities, warranting further investigation in research and development contexts.

Formula: C₁₃H₈F₂O₂

InChI: InChI=1S/C13H8F2O2/c14-11-3-1-8(2-4-11)9-5-10(13(16)17)7-12(15)6-9/h1-7H,(H,16,17)

InChI key: InChIKey=AOESPRFGWJYJER-UHFFFAOYSA-N

SMILES: C(O)(=O)C=1C=C(C=C(F)C1)C2=CC=C(F)C=C2

Synonyms:

• 4′,5-Difluoro[1,1′-biphenyl]-3-carboxylic acid
• [1,1′-Biphenyl]-3-carboxylic acid, 4′,5-difluoro-

3-(4-Fluorophenyl)-5-fluorobenzoic acid

CAS: 1214330-80-9

Formula: C₁₃H₈F₂O₂

Molecular weight: 234.1982

Ref: IN-DA0014SC