CymitQuimica logo

CAS 1214331-56-2

:

2-Pyridinamine, 5-fluoro-3-phenyl-

Description:
2-Pyridinamine, 5-fluoro-3-phenyl- is an organic compound characterized by its pyridine ring structure, which is a six-membered aromatic ring containing one nitrogen atom. The presence of the amino group (-NH2) at the second position and a fluorine atom at the fifth position of the pyridine ring contributes to its reactivity and potential applications in medicinal chemistry. The phenyl group at the third position enhances its lipophilicity, which can influence its biological activity and solubility properties. This compound may exhibit various chemical behaviors, including hydrogen bonding due to the amino group and potential electrophilic substitution reactions due to the electron-withdrawing nature of the fluorine atom. Its unique structure may make it a candidate for research in pharmaceuticals, particularly in the development of compounds with specific biological activities. As with many nitrogen-containing heterocycles, it may also participate in coordination chemistry, forming complexes with metal ions. Safety and handling precautions should be observed, as with all chemical substances, due to potential toxicity or reactivity.
Formula:C11H9FN2
InChI:InChI=1S/C11H9FN2/c12-9-6-10(11(13)14-7-9)8-4-2-1-3-5-8/h1-7H,(H2,13,14)
InChI key:InChIKey=HREWVMSLQBUQJM-UHFFFAOYSA-N
SMILES:NC1=C(C=C(F)C=N1)C2=CC=CC=C2
Synonyms:
  • 2-Pyridinamine, 5-fluoro-3-phenyl-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.