
CAS 1214331-91-5
:4-(2-Fluorophenyl)-2-thiophenecarboxylic acid
Description:
4-(2-Fluorophenyl)-2-thiophenecarboxylic acid is an organic compound characterized by its unique structure, which includes a thiophene ring and a fluorophenyl group. This compound features a carboxylic acid functional group, contributing to its acidic properties. The presence of the fluorine atom in the phenyl ring can influence the compound's reactivity and polarity, potentially enhancing its biological activity or solubility in various solvents. The thiophene moiety adds to the compound's aromatic character, which can affect its electronic properties and interactions with other molecules. Such compounds are often of interest in medicinal chemistry and materials science due to their potential applications in pharmaceuticals, agrochemicals, and organic electronics. The specific interactions and stability of this compound can be influenced by factors such as pH, temperature, and the presence of other functional groups or solvents. Overall, 4-(2-Fluorophenyl)-2-thiophenecarboxylic acid represents a versatile structure with potential utility in various chemical and biological contexts.
Formula:C11H7FO2S
InChI:InChI=1S/C11H7FO2S/c12-9-4-2-1-3-8(9)7-5-10(11(13)14)15-6-7/h1-6H,(H,13,14)
InChI key:InChIKey=IMJGANUSSDWOAF-UHFFFAOYSA-N
SMILES:FC1=C(C=CC=C1)C=2C=C(C(O)=O)SC2
Synonyms:- 2-Thiophenecarboxylic acid, 4-(2-fluorophenyl)-
- 4-(2-Fluorophenyl)-2-thiophenecarboxylic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.