CAS 1214332-32-7

2,4′-Difluoro[1,1′-biphenyl]-3-carboxylic acid

Description:

2,4′-Difluoro[1,1′-biphenyl]-3-carboxylic acid is an organic compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. The presence of two fluorine atoms at the 2 and 4′ positions on the biphenyl framework contributes to its unique chemical properties, including increased lipophilicity and potential for enhanced biological activity. The carboxylic acid functional group at the 3-position introduces acidity and reactivity, allowing for various chemical transformations and interactions. This compound is likely to exhibit moderate solubility in organic solvents and limited solubility in water due to its hydrophobic biphenyl core. Its fluorinated nature may also influence its stability and reactivity, making it of interest in fields such as medicinal chemistry and materials science. Additionally, the compound's structure suggests potential applications in agrochemicals or pharmaceuticals, where fluorinated compounds often exhibit improved efficacy and selectivity. Overall, 2,4′-Difluoro[1,1′-biphenyl]-3-carboxylic acid represents a versatile building block in organic synthesis.

Formula: C₁₃H₈F₂O₂

InChI: InChI=1S/C13H8F2O2/c14-9-6-4-8(5-7-9)10-2-1-3-11(12(10)15)13(16)17/h1-7H,(H,16,17)

InChI key: InChIKey=LDISIDUNBSMZHP-UHFFFAOYSA-N

SMILES: FC1=C(C=CC=C1C(O)=O)C2=CC=C(F)C=C2

Synonyms:

• 2,4′-Difluoro[1,1′-biphenyl]-3-carboxylic acid
• [1,1′-Biphenyl]-3-carboxylic acid, 2,4′-difluoro-

2-Fluoro-3-(4-fluorophenyl)benzoic acid

CAS: 1214332-32-7

Formula: C₁₃H₈F₂O₂

Molecular weight: 234.1982

Ref: IN-DA0014TG