CymitQuimica logo

CAS 1214332-33-8

:

3-Bromo-1,6-dihydro-6-oxo-2-pyridinecarboxylic acid

Description:
3-Bromo-1,6-dihydro-6-oxo-2-pyridinecarboxylic acid is a heterocyclic organic compound characterized by its pyridine ring structure, which is substituted with a bromine atom and a carboxylic acid functional group. This compound features a diketone structure due to the presence of a keto group at the 6-position of the pyridine ring. The bromine substitution introduces notable reactivity, making it a potential candidate for various chemical reactions, including nucleophilic substitutions and coupling reactions. The carboxylic acid group contributes to its acidity and solubility in polar solvents, which can influence its behavior in biological systems and chemical applications. Additionally, the compound may exhibit biological activity, making it of interest in pharmaceutical research. Its unique structural features and functional groups suggest potential applications in medicinal chemistry, agrochemicals, or as intermediates in organic synthesis. As with many heterocycles, the compound's properties, such as melting point, boiling point, and reactivity, can vary based on environmental conditions and the presence of other functional groups.
Formula:C6H4BrNO3
InChI:InChI=1S/C6H4BrNO3/c7-3-1-2-4(9)8-5(3)6(10)11/h1-2H,(H,8,9)(H,10,11)
InChI key:InChIKey=QWHCFOZKEOSNCO-UHFFFAOYSA-N
SMILES:C(O)(=O)C1=C(Br)C=CC(=O)N1
Synonyms:
  • 3-Bromo-1,6-dihydro-6-oxo-2-pyridinecarboxylic acid
  • 2-Pyridinecarboxylic acid, 3-bromo-1,6-dihydro-6-oxo-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.