CymitQuimica logo

CAS 1214332-34-9

:

2,4′-Difluoro[1,1′-biphenyl]-4-carboxylic acid

Description:
2,4′-Difluoro[1,1′-biphenyl]-4-carboxylic acid is an organic compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. The presence of two fluorine atoms at the 2 and 4' positions of the biphenyl framework contributes to its unique chemical properties, including increased lipophilicity and potential for enhanced reactivity. The carboxylic acid functional group at the 4 position introduces acidity and polar characteristics, making the compound soluble in polar solvents. This compound may exhibit interesting biological activity due to its structural features, which can influence interactions with biological targets. Additionally, the fluorine substituents can enhance metabolic stability and alter the compound's electronic properties. Its applications may span various fields, including pharmaceuticals, agrochemicals, and materials science, where such modifications can lead to improved performance or specificity. As with many fluorinated compounds, safety and environmental considerations are important, given the potential persistence and bioaccumulation of fluorinated substances.
Formula:C13H8F2O2
InChI:InChI=1S/C13H8F2O2/c14-10-4-1-8(2-5-10)11-6-3-9(13(16)17)7-12(11)15/h1-7H,(H,16,17)
InChI key:InChIKey=MQXNAKMJSLMGJT-UHFFFAOYSA-N
SMILES:FC1=C(C=CC(C(O)=O)=C1)C2=CC=C(F)C=C2
Synonyms:
  • [1,1′-Biphenyl]-4-carboxylic acid, 2,4′-difluoro-
  • 2,4′-Difluoro[1,1′-biphenyl]-4-carboxylic acid
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.