CAS 1214332-50-9

2,2′-Difluoro[1,1′-biphenyl]-3-methanol

Description:

2,2′-Difluoro[1,1′-biphenyl]-3-methanol is an organic compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. The presence of two fluorine atoms at the 2 and 2' positions of the biphenyl moiety introduces significant electronegativity, influencing the compound's reactivity and physical properties. The hydroxymethyl group (-CH2OH) at the 3-position adds hydrophilicity, making the compound potentially soluble in polar solvents. This compound may exhibit interesting chemical behavior due to the combination of its fluorinated and hydroxymethyl functionalities, which can affect its interactions in various chemical environments. Additionally, the presence of fluorine can enhance the compound's stability and alter its electronic properties, making it of interest in fields such as materials science and medicinal chemistry. Its specific applications and behavior would depend on further studies, including its synthesis, reactivity, and potential uses in various chemical processes or as a precursor in organic synthesis.

Formula: C₁₃H₁₀F₂O

InChI: InChI=1S/C13H10F2O/c14-12-7-2-1-5-10(12)11-6-3-4-9(8-16)13(11)15/h1-7,16H,8H2

InChI key: InChIKey=UXIAREIWMZOAIS-UHFFFAOYSA-N

SMILES: FC1=C(C=CC=C1CO)C2=C(F)C=CC=C2

Synonyms:

• 2,2′-Difluoro[1,1′-biphenyl]-3-methanol
• [1,1′-Biphenyl]-3-methanol, 2,2′-difluoro-