CAS 1214332-84-9

2-Chloro-6-(difluoromethoxy)-4-pyridinecarboxylic acid

Description:

2-Chloro-6-(difluoromethoxy)-4-pyridinecarboxylic acid is a chemical compound characterized by its pyridine ring, which is a six-membered aromatic heterocycle containing one nitrogen atom. The presence of a carboxylic acid functional group (-COOH) indicates that it can act as an acid, capable of donating a proton in solution. The compound features a chloro substituent at the 2-position and a difluoromethoxy group at the 6-position, which can influence its reactivity and solubility. The difluoromethoxy group, consisting of a methoxy (-OCH3) moiety with two fluorine atoms, enhances the compound's lipophilicity and may affect its biological activity. This compound may be of interest in pharmaceutical research due to its potential applications in drug development, particularly in targeting specific biological pathways. Its unique structure suggests that it could exhibit interesting properties, such as selective inhibition or modulation of enzyme activity, making it a candidate for further investigation in medicinal chemistry.

Formula: C₇H₄ClF₂NO₃

InChI: InChI=1S/C7H4ClF2NO3/c8-4-1-3(6(12)13)2-5(11-4)14-7(9)10/h1-2,7H,(H,12,13)

InChI key: InChIKey=SPLZJTAUBSIWEH-UHFFFAOYSA-N

SMILES: O(C(F)F)C1=CC(C(O)=O)=CC(Cl)=N1

Synonyms:

• 2-Chloro-6-(difluoromethoxy)-4-pyridinecarboxylic acid
• 4-Pyridinecarboxylic acid, 2-chloro-6-(difluoromethoxy)-

2-Chloro-6-(difluoromethoxy)pyridine-4-carboxylic acid

CAS: 1214332-84-9

Versatile small molecule scaffold

Formula: C₇H₄ClF₂NO₃

Purity: Min. 95%

Molecular weight: 223.56 g/mol

Ref: 3D-PYB33284